C34H42N4O8S — CID 110207181
ethyl 2-[2-[[(2S,3R)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-3-methylpentanoyl]amino]-1,3-thiazol-4-yl]acetate (PubChem CID 110207181) has the molecular formula C34H42N4O8S and a molecular weight of 666.80 g/mol. Its IUPAC name is ethyl 2-[2-[[(2S,3R)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-3-methylpentanoyl]amino]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[[(2S,3R)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-3-methylpentanoyl]amino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 110207181 |
| Molecular Formula | C34H42N4O8S |
| Molecular Weight | 666.80 g/mol |
| Exact Mass | 666.27 |
| IUPAC Name | ethyl 2-[2-[[(2S,3R)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-3-methylpentanoyl]amino]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NC(=O)[C@@H](Nc2ccc3c(cc2=O)[C@@H](NC(C)=O)CCc2cc(OC)c(OC)c(OC)c2-3)[C@H](C)CC)n1 |
| InChI | InChI=1S/C34H42N4O8S/c1-8-18(3)30(33(42)38-34-36-21(17-47-34)15-28(41)46-9-2)37-25-13-11-22-23(16-26(25)40)24(35-19(4)39)12-10-20-14-27(43-5)31(44-6)32(45-7)29(20)22/h11,13-14,16-18,24,30H,8-10,12,15H2,1-7H3,(H,35,39)(H,37,40)(H,36,38,42)/t18-,24+,30+/m1/s1 |
| InChIKey | XFXPCGRCCFALBW-RWVMMXNJSA-N |
| XLogP | 4.89 |
| TPSA | 154.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.80 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |