C33H40N4O8S — CID 75491564
ethyl 2-[2-[[(2S)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-3-methylbutanoyl]amino]-1,3-thiazol-4-yl]acetate (PubChem CID 75491564) has the molecular formula C33H40N4O8S and a molecular weight of 652.77 g/mol. Its IUPAC name is ethyl 2-[2-[[(2S)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-3-methylbutanoyl]amino]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[[(2S)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-3-methylbutanoyl]amino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 75491564 |
| Molecular Formula | C33H40N4O8S |
| Molecular Weight | 652.77 g/mol |
| Exact Mass | 652.26 |
| IUPAC Name | ethyl 2-[2-[[(2S)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-3-methylbutanoyl]amino]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NC(=O)[C@@H](Nc2ccc3c(cc2=O)[C@@H](NC(C)=O)CCc2cc(OC)c(OC)c(OC)c2-3)C(C)C)n1 |
| InChI | InChI=1S/C33H40N4O8S/c1-8-45-27(40)14-20-16-46-33(35-20)37-32(41)29(17(2)3)36-24-12-10-21-22(15-25(24)39)23(34-18(4)38)11-9-19-13-26(42-5)30(43-6)31(44-7)28(19)21/h10,12-13,15-17,23,29H,8-9,11,14H2,1-7H3,(H,34,38)(H,36,39)(H,35,37,41)/t23-,29-/m0/s1 |
| InChIKey | OVHLXQDNXUCYJG-IADCTJSHSA-N |
| XLogP | 4.50 |
| TPSA | 154.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.77 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |