C28H32N4O6S — CID 75492045
(2S)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-(4-methyl-1,3-thiazol-2-yl)propanamide (PubChem CID 75492045) has the molecular formula C28H32N4O6S and a molecular weight of 552.65 g/mol. Its IUPAC name is (2S)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-(4-methyl-1,3-thiazol-2-yl)propanamide.
| Compound Name | (2S)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-(4-methyl-1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 75492045 |
| Molecular Formula | C28H32N4O6S |
| Molecular Weight | 552.65 g/mol |
| Exact Mass | 552.20 |
| IUPAC Name | (2S)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-(4-methyl-1,3-thiazol-2-yl)propanamide |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(N[C@@H](C)C(=O)Nc3nc(C)cs3)c(=O)cc1[C@@H](NC(C)=O)CC2 |
| InChI | InChI=1S/C28H32N4O6S/c1-14-13-39-28(29-14)32-27(35)15(2)30-21-10-8-18-19(12-22(21)34)20(31-16(3)33)9-7-17-11-23(36-4)25(37-5)26(38-6)24(17)18/h8,10-13,15,20H,7,9H2,1-6H3,(H,30,34)(H,31,33)(H,29,32,35)/t15-,20-/m0/s1 |
| InChIKey | HPTVWALQDYRVJP-YWZLYKJASA-N |
| XLogP | 4.07 |
| TPSA | 127.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.65 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |