C30H36N4O6S — CID 75491533
(2S)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-3-methyl-N-(5-methyl-1,3-thiazol-2-yl)butanamide (PubChem CID 75491533) has the molecular formula C30H36N4O6S and a molecular weight of 580.71 g/mol. Its IUPAC name is (2S)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-3-methyl-N-(5-methyl-1,3-thiazol-2-yl)butanamide.
| Compound Name | (2S)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-3-methyl-N-(5-methyl-1,3-thiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 75491533 |
| Molecular Formula | C30H36N4O6S |
| Molecular Weight | 580.71 g/mol |
| Exact Mass | 580.24 |
| IUPAC Name | (2S)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-3-methyl-N-(5-methyl-1,3-thiazol-2-yl)butanamide |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(N[C@H](C(=O)Nc3ncc(C)s3)C(C)C)c(=O)cc1[C@@H](NC(C)=O)CC2 |
| InChI | InChI=1S/C30H36N4O6S/c1-15(2)26(29(37)34-30-31-14-16(3)41-30)33-22-11-9-19-20(13-23(22)36)21(32-17(4)35)10-8-18-12-24(38-5)27(39-6)28(40-7)25(18)19/h9,11-15,21,26H,8,10H2,1-7H3,(H,32,35)(H,33,36)(H,31,34,37)/t21-,26-/m0/s1 |
| InChIKey | RUZOZYLQBNSQRQ-LVXARBLLSA-N |
| XLogP | 4.70 |
| TPSA | 127.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.71 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |