C31H38N4O6S — CID 124864304
(2R)-2-[[(7R)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-4-methyl-N-(5-methyl-1,3-thiazol-2-yl)pentanamide (PubChem CID 124864304) has the molecular formula C31H38N4O6S and a molecular weight of 594.73 g/mol. Its IUPAC name is (2R)-2-[[(7R)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-4-methyl-N-(5-methyl-1,3-thiazol-2-yl)pentanamide.
| Compound Name | (2R)-2-[[(7R)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-4-methyl-N-(5-methyl-1,3-thiazol-2-yl)pentanamide |
|---|---|
| PubChem CID | 124864304 |
| Molecular Formula | C31H38N4O6S |
| Molecular Weight | 594.73 g/mol |
| Exact Mass | 594.25 |
| IUPAC Name | (2R)-2-[[(7R)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-4-methyl-N-(5-methyl-1,3-thiazol-2-yl)pentanamide |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(N[C@H](CC(C)C)C(=O)Nc3ncc(C)s3)c(=O)cc1[C@H](NC(C)=O)CC2 |
| InChI | InChI=1S/C31H38N4O6S/c1-16(2)12-24(30(38)35-31-32-15-17(3)42-31)34-23-11-9-20-21(14-25(23)37)22(33-18(4)36)10-8-19-13-26(39-5)28(40-6)29(41-7)27(19)20/h9,11,13-16,22,24H,8,10,12H2,1-7H3,(H,33,36)(H,34,37)(H,32,35,38)/t22-,24-/m1/s1 |
| InChIKey | XMAFGGBRFXTKHE-ISKFKSNPSA-N |
| XLogP | 5.09 |
| TPSA | 127.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.73 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |