C29H34N4O6S — CID 75492564
(2S)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-(4,5-dimethyl-1,3-thiazol-2-yl)propanamide (PubChem CID 75492564) has the molecular formula C29H34N4O6S and a molecular weight of 566.68 g/mol. Its IUPAC name is (2S)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-(4,5-dimethyl-1,3-thiazol-2-yl)propanamide.
| Compound Name | (2S)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-(4,5-dimethyl-1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 75492564 |
| Molecular Formula | C29H34N4O6S |
| Molecular Weight | 566.68 g/mol |
| Exact Mass | 566.22 |
| IUPAC Name | (2S)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-(4,5-dimethyl-1,3-thiazol-2-yl)propanamide |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(N[C@@H](C)C(=O)Nc3nc(C)c(C)s3)c(=O)cc1[C@@H](NC(C)=O)CC2 |
| InChI | InChI=1S/C29H34N4O6S/c1-14-16(3)40-29(31-14)33-28(36)15(2)30-22-11-9-19-20(13-23(22)35)21(32-17(4)34)10-8-18-12-24(37-5)26(38-6)27(39-7)25(18)19/h9,11-13,15,21H,8,10H2,1-7H3,(H,30,35)(H,32,34)(H,31,33,36)/t15-,21-/m0/s1 |
| InChIKey | WGZGKAOWAZUFDR-BTYIYWSLSA-N |
| XLogP | 4.38 |
| TPSA | 127.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.68 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |