C32H38N4O8S — CID 124863530
methyl 2-[[(2R)-2-[[(7R)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]propanoyl]amino]-5-propan-2-yl-1,3-thiazole-4-carboxylate (PubChem CID 124863530) has the molecular formula C32H38N4O8S and a molecular weight of 638.74 g/mol. Its IUPAC name is methyl 2-[[(2R)-2-[[(7R)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]propanoyl]amino]-5-propan-2-yl-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-[[(2R)-2-[[(7R)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]propanoyl]amino]-5-propan-2-yl-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 124863530 |
| Molecular Formula | C32H38N4O8S |
| Molecular Weight | 638.74 g/mol |
| Exact Mass | 638.24 |
| IUPAC Name | methyl 2-[[(2R)-2-[[(7R)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]propanoyl]amino]-5-propan-2-yl-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1nc(NC(=O)[C@@H](C)Nc2ccc3c(cc2=O)[C@H](NC(C)=O)CCc2cc(OC)c(OC)c(OC)c2-3)sc1C(C)C |
| InChI | InChI=1S/C32H38N4O8S/c1-15(2)29-26(31(40)44-8)35-32(45-29)36-30(39)16(3)33-22-12-10-19-20(14-23(22)38)21(34-17(4)37)11-9-18-13-24(41-5)27(42-6)28(43-7)25(18)19/h10,12-16,21H,9,11H2,1-8H3,(H,33,38)(H,34,37)(H,35,36,39)/t16-,21-/m1/s1 |
| InChIKey | SPCYCXYTPMWFRD-IIBYNOLFSA-N |
| XLogP | 4.67 |
| TPSA | 154.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.74 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |