C35H44N4O8S — CID 75531856
methyl 2-[[2-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-3-methylbutanoyl]amino]-5-(2-methylpropyl)-1,3-thiazole-4-carboxylate (PubChem CID 75531856) has the molecular formula C35H44N4O8S and a molecular weight of 680.82 g/mol. Its IUPAC name is methyl 2-[[2-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-3-methylbutanoyl]amino]-5-(2-methylpropyl)-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-[[2-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-3-methylbutanoyl]amino]-5-(2-methylpropyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 75531856 |
| Molecular Formula | C35H44N4O8S |
| Molecular Weight | 680.82 g/mol |
| Exact Mass | 680.29 |
| IUPAC Name | methyl 2-[[2-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-3-methylbutanoyl]amino]-5-(2-methylpropyl)-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1nc(NC(=O)C(Nc2ccc3c(cc2=O)C(NC(C)=O)CCc2cc(OC)c(OC)c(OC)c2-3)C(C)C)sc1CC(C)C |
| InChI | InChI=1S/C35H44N4O8S/c1-17(2)14-27-30(34(43)47-9)38-35(48-27)39-33(42)29(18(3)4)37-24-13-11-21-22(16-25(24)41)23(36-19(5)40)12-10-20-15-26(44-6)31(45-7)32(46-8)28(20)21/h11,13,15-18,23,29H,10,12,14H2,1-9H3,(H,36,40)(H,37,41)(H,38,39,42) |
| InChIKey | UROPIGYUIUTYAV-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 154.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.82 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |