C30H37N5O7S — CID 75491789
(2S)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-[5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]-3-methylbutanamide (PubChem CID 75491789) has the molecular formula C30H37N5O7S and a molecular weight of 611.72 g/mol. Its IUPAC name is (2S)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-[5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]-3-methylbutanamide.
| Compound Name | (2S)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-[5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]-3-methylbutanamide |
|---|---|
| PubChem CID | 75491789 |
| Molecular Formula | C30H37N5O7S |
| Molecular Weight | 611.72 g/mol |
| Exact Mass | 611.24 |
| IUPAC Name | (2S)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-[5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]-3-methylbutanamide |
| SMILES | COCc1nnc(NC(=O)[C@@H](Nc2ccc3c(cc2=O)[C@@H](NC(C)=O)CCc2cc(OC)c(OC)c(OC)c2-3)C(C)C)s1 |
| InChI | InChI=1S/C30H37N5O7S/c1-15(2)26(29(38)33-30-35-34-24(43-30)14-39-4)32-21-11-9-18-19(13-22(21)37)20(31-16(3)36)10-8-17-12-23(40-5)27(41-6)28(42-7)25(17)18/h9,11-13,15,20,26H,8,10,14H2,1-7H3,(H,31,36)(H,32,37)(H,33,35,38)/t20-,26-/m0/s1 |
| InChIKey | HHSOSLBNTSTUPQ-FNZWTVRRSA-N |
| XLogP | 3.94 |
| TPSA | 150.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.72 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |