C30H37N5O7S2 — CID 127253647
(2S)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-[5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]-4-methylsulfanylbutanamide (PubChem CID 127253647) has the molecular formula C30H37N5O7S2 and a molecular weight of 643.79 g/mol. Its IUPAC name is (2S)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-[5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]-4-methylsulfanylbutanamide.
| Compound Name | (2S)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-[5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 127253647 |
| Molecular Formula | C30H37N5O7S2 |
| Molecular Weight | 643.79 g/mol |
| Exact Mass | 643.21 |
| IUPAC Name | (2S)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-[5-(methoxymethyl)-1,3,4-thiadiazol-2-yl]-4-methylsulfanylbutanamide |
| SMILES | COCc1nnc(NC(=O)[C@H](CCSC)Nc2ccc3c(cc2=O)[C@@H](NC(C)=O)CCc2cc(OC)c(OC)c(OC)c2-3)s1 |
| InChI | InChI=1S/C30H37N5O7S2/c1-16(36)31-20-9-7-17-13-24(40-3)27(41-4)28(42-5)26(17)18-8-10-21(23(37)14-19(18)20)32-22(11-12-43-6)29(38)33-30-35-34-25(44-30)15-39-2/h8,10,13-14,20,22H,7,9,11-12,15H2,1-6H3,(H,31,36)(H,32,37)(H,33,35,38)/t20-,22-/m0/s1 |
| InChIKey | VJMQBDYXWWOEKM-UNMCSNQZSA-N |
| XLogP | 4.03 |
| TPSA | 150.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.79 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |