C33H37N3O8S — CID 124862114
(2R)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-(1,3-benzodioxol-5-yl)-4-methylsulfanylbutanamide (PubChem CID 124862114) has the molecular formula C33H37N3O8S and a molecular weight of 635.74 g/mol. Its IUPAC name is (2R)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-(1,3-benzodioxol-5-yl)-4-methylsulfanylbutanamide.
| Compound Name | (2R)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-(1,3-benzodioxol-5-yl)-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 124862114 |
| Molecular Formula | C33H37N3O8S |
| Molecular Weight | 635.74 g/mol |
| Exact Mass | 635.23 |
| IUPAC Name | (2R)-2-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-(1,3-benzodioxol-5-yl)-4-methylsulfanylbutanamide |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(N[C@H](CCSC)C(=O)Nc3ccc4c(c3)OCO4)c(=O)cc1[C@@H](NC(C)=O)CC2 |
| InChI | InChI=1S/C33H37N3O8S/c1-18(37)34-23-9-6-19-14-29(40-2)31(41-3)32(42-4)30(19)21-8-10-24(26(38)16-22(21)23)36-25(12-13-45-5)33(39)35-20-7-11-27-28(15-20)44-17-43-27/h7-8,10-11,14-16,23,25H,6,9,12-13,17H2,1-5H3,(H,34,37)(H,35,39)(H,36,38)/t23-,25+/m0/s1 |
| InChIKey | LIDRZWHCAFXAAU-UKILVPOCSA-N |
| XLogP | 4.76 |
| TPSA | 133.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.74 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |