C36H38N4O8S2 — CID 163091469
2-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-N-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-4-methylsulfanylbutanamide (PubChem CID 163091469) has the molecular formula C36H38N4O8S2 and a molecular weight of 718.85 g/mol. Its IUPAC name is 2-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-N-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-4-methylsulfanylbutanamide.
| Compound Name | 2-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-N-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 163091469 |
| Molecular Formula | C36H38N4O8S2 |
| Molecular Weight | 718.85 g/mol |
| Exact Mass | 718.21 |
| IUPAC Name | 2-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-N-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-4-methylsulfanylbutanamide |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(NC(CCSC)C(=O)Nc3nc(-c4ccc5c(c4)OCO5)cs3)c(=O)cc1C(NC(C)=O)CC2 |
| InChI | InChI=1S/C36H38N4O8S2/c1-19(41)37-24-9-6-21-15-31(44-2)33(45-3)34(46-4)32(21)22-8-10-25(28(42)16-23(22)24)38-26(12-13-49-5)35(43)40-36-39-27(17-50-36)20-7-11-29-30(14-20)48-18-47-29/h7-8,10-11,14-17,24,26H,6,9,12-13,18H2,1-5H3,(H,37,41)(H,38,42)(H,39,40,43) |
| InChIKey | WYWBYUTXQBLLSE-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 146.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.85 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |