C34H37N5O6S2 — CID 124862485
(2R)-2-[[(7R)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-4-methylsulfanyl-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)butanamide (PubChem CID 124862485) has the molecular formula C34H37N5O6S2 and a molecular weight of 675.83 g/mol. Its IUPAC name is (2R)-2-[[(7R)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-4-methylsulfanyl-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)butanamide.
| Compound Name | (2R)-2-[[(7R)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-4-methylsulfanyl-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 124862485 |
| Molecular Formula | C34H37N5O6S2 |
| Molecular Weight | 675.83 g/mol |
| Exact Mass | 675.22 |
| IUPAC Name | (2R)-2-[[(7R)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-4-methylsulfanyl-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)butanamide |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(N[C@H](CCSC)C(=O)Nc3nc(-c4ccccn4)cs3)c(=O)cc1[C@H](NC(C)=O)CC2 |
| InChI | InChI=1S/C34H37N5O6S2/c1-19(40)36-23-11-9-20-16-29(43-2)31(44-3)32(45-4)30(20)21-10-12-25(28(41)17-22(21)23)37-26(13-15-46-5)33(42)39-34-38-27(18-47-34)24-8-6-7-14-35-24/h6-8,10,12,14,16-18,23,26H,9,11,13,15H2,1-5H3,(H,36,40)(H,37,41)(H,38,39,42)/t23-,26-/m1/s1 |
| InChIKey | NDYSFMLAEUAHDA-ZEQKJWHPSA-N |
| XLogP | 5.55 |
| TPSA | 140.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.83 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |