C32H39N5O7S — CID 163095116
2-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-N-[4-(2-amino-2-oxoethyl)-1,3-thiazol-2-yl]-3-methylpentanamide (PubChem CID 163095116) has the molecular formula C32H39N5O7S and a molecular weight of 637.76 g/mol. Its IUPAC name is 2-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-N-[4-(2-amino-2-oxoethyl)-1,3-thiazol-2-yl]-3-methylpentanamide.
| Compound Name | 2-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-N-[4-(2-amino-2-oxoethyl)-1,3-thiazol-2-yl]-3-methylpentanamide |
|---|---|
| PubChem CID | 163095116 |
| Molecular Formula | C32H39N5O7S |
| Molecular Weight | 637.76 g/mol |
| Exact Mass | 637.26 |
| IUPAC Name | 2-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-N-[4-(2-amino-2-oxoethyl)-1,3-thiazol-2-yl]-3-methylpentanamide |
| SMILES | CCC(C)C(Nc1ccc2c(cc1=O)C(NC(C)=O)CCc1cc(OC)c(OC)c(OC)c1-2)C(=O)Nc1nc(CC(N)=O)cs1 |
| InChI | InChI=1S/C32H39N5O7S/c1-7-16(2)28(31(41)37-32-35-19(15-45-32)13-26(33)40)36-23-11-9-20-21(14-24(23)39)22(34-17(3)38)10-8-18-12-25(42-4)29(43-5)30(44-6)27(18)20/h9,11-12,14-16,22,28H,7-8,10,13H2,1-6H3,(H2,33,40)(H,34,38)(H,36,39)(H,35,37,41) |
| InChIKey | LEOZRPADIDTIEG-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 170.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.76 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |