C39H49N5O6 — CID 125428631
6-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-[5-(1H-benzimidazol-2-yl)pentyl]hexanamide (PubChem CID 125428631) has the molecular formula C39H49N5O6 and a molecular weight of 683.85 g/mol. Its IUPAC name is 6-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-[5-(1H-benzimidazol-2-yl)pentyl]hexanamide.
| Compound Name | 6-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-[5-(1H-benzimidazol-2-yl)pentyl]hexanamide |
|---|---|
| PubChem CID | 125428631 |
| Molecular Formula | C39H49N5O6 |
| Molecular Weight | 683.85 g/mol |
| Exact Mass | 683.37 |
| IUPAC Name | 6-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-[5-(1H-benzimidazol-2-yl)pentyl]hexanamide |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(NCCCCCC(=O)NCCCCCc3nc4ccccc4[nH]3)c(=O)cc1[C@@H](NC(C)=O)CC2 |
| InChI | InChI=1S/C39H49N5O6/c1-25(45)42-29-19-17-26-23-34(48-2)38(49-3)39(50-4)37(26)27-18-20-32(33(46)24-28(27)29)40-21-11-6-8-16-36(47)41-22-12-5-7-15-35-43-30-13-9-10-14-31(30)44-35/h9-10,13-14,18,20,23-24,29H,5-8,11-12,15-17,19,21-22H2,1-4H3,(H,40,46)(H,41,47)(H,42,45)(H,43,44)/t29-/m0/s1 |
| InChIKey | RISJIOTXFSBJER-LJAQVGFWSA-N |
| XLogP | 6.24 |
| TPSA | 143.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.85 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|