C33H40N4O6 — CID 124861009
6-[[(7R)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-(pyridin-2-ylmethyl)hexanamide (PubChem CID 124861009) has the molecular formula C33H40N4O6 and a molecular weight of 588.71 g/mol. Its IUPAC name is 6-[[(7R)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-(pyridin-2-ylmethyl)hexanamide.
| Compound Name | 6-[[(7R)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-(pyridin-2-ylmethyl)hexanamide |
|---|---|
| PubChem CID | 124861009 |
| Molecular Formula | C33H40N4O6 |
| Molecular Weight | 588.71 g/mol |
| Exact Mass | 588.29 |
| IUPAC Name | 6-[[(7R)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-(pyridin-2-ylmethyl)hexanamide |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(NCCCCCC(=O)NCc3ccccn3)c(=O)cc1[C@H](NC(C)=O)CC2 |
| InChI | InChI=1S/C33H40N4O6/c1-21(38)37-26-14-12-22-18-29(41-2)32(42-3)33(43-4)31(22)24-13-15-27(28(39)19-25(24)26)35-17-8-5-6-11-30(40)36-20-23-10-7-9-16-34-23/h7,9-10,13,15-16,18-19,26H,5-6,8,11-12,14,17,20H2,1-4H3,(H,35,39)(H,36,40)(H,37,38)/t26-/m1/s1 |
| InChIKey | FRUFFSVEDLVYLY-AREMUKBSSA-N |
| XLogP | 4.55 |
| TPSA | 127.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.71 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|