C33H37N7O6 — CID 163090256
4-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-N-[3-(2-methyltetrazol-5-yl)phenyl]butanamide (PubChem CID 163090256) has the molecular formula C33H37N7O6 and a molecular weight of 627.70 g/mol. Its IUPAC name is 4-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-N-[3-(2-methyltetrazol-5-yl)phenyl]butanamide.
| Compound Name | 4-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-N-[3-(2-methyltetrazol-5-yl)phenyl]butanamide |
|---|---|
| PubChem CID | 163090256 |
| Molecular Formula | C33H37N7O6 |
| Molecular Weight | 627.70 g/mol |
| Exact Mass | 627.28 |
| IUPAC Name | 4-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-N-[3-(2-methyltetrazol-5-yl)phenyl]butanamide |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(NCCCC(=O)Nc3cccc(-c4nnn(C)n4)c3)c(=O)cc1C(NC(C)=O)CC2 |
| InChI | InChI=1S/C33H37N7O6/c1-19(41)35-25-13-11-20-17-28(44-3)31(45-4)32(46-5)30(20)23-12-14-26(27(42)18-24(23)25)34-15-7-10-29(43)36-22-9-6-8-21(16-22)33-37-39-40(2)38-33/h6,8-9,12,14,16-18,25H,7,10-11,13,15H2,1-5H3,(H,34,42)(H,35,41)(H,36,43) |
| InChIKey | LUPYEDBRDJKHAF-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 158.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.70 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|