C33H36N6O7 — CID 126417660
2-[[(7R)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-[3-[5-(methoxymethyl)-1H-1,2,4-triazol-3-yl]phenyl]acetamide (PubChem CID 126417660) has the molecular formula C33H36N6O7 and a molecular weight of 628.69 g/mol. Its IUPAC name is 2-[[(7R)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-[3-[5-(methoxymethyl)-1H-1,2,4-triazol-3-yl]phenyl]acetamide.
| Compound Name | 2-[[(7R)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-[3-[5-(methoxymethyl)-1H-1,2,4-triazol-3-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 126417660 |
| Molecular Formula | C33H36N6O7 |
| Molecular Weight | 628.69 g/mol |
| Exact Mass | 628.26 |
| IUPAC Name | 2-[[(7R)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-N-[3-[5-(methoxymethyl)-1H-1,2,4-triazol-3-yl]phenyl]acetamide |
| SMILES | COCc1nc(-c2cccc(NC(=O)CNc3ccc4c(cc3=O)[C@H](NC(C)=O)CCc3cc(OC)c(OC)c(OC)c3-4)c2)n[nH]1 |
| InChI | InChI=1S/C33H36N6O7/c1-18(40)35-24-11-9-19-14-27(44-3)31(45-4)32(46-5)30(19)22-10-12-25(26(41)15-23(22)24)34-16-29(42)36-21-8-6-7-20(13-21)33-37-28(17-43-2)38-39-33/h6-8,10,12-15,24H,9,11,16-17H2,1-5H3,(H,34,41)(H,35,40)(H,36,42)(H,37,38,39)/t24-/m1/s1 |
| InChIKey | NRCPISHKHRWCBP-XMMPIXPASA-N |
| XLogP | 3.85 |
| TPSA | 165.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.69 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |