C36H42N4O7 — CID 110210085
4-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-N-[1-(2-methoxyethyl)indol-4-yl]butanamide (PubChem CID 110210085) has the molecular formula C36H42N4O7 and a molecular weight of 642.75 g/mol. Its IUPAC name is 4-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-N-[1-(2-methoxyethyl)indol-4-yl]butanamide.
| Compound Name | 4-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-N-[1-(2-methoxyethyl)indol-4-yl]butanamide |
|---|---|
| PubChem CID | 110210085 |
| Molecular Formula | C36H42N4O7 |
| Molecular Weight | 642.75 g/mol |
| Exact Mass | 642.31 |
| IUPAC Name | 4-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-N-[1-(2-methoxyethyl)indol-4-yl]butanamide |
| SMILES | COCCn1ccc2c(NC(=O)CCCNc3ccc4c(cc3=O)C(NC(C)=O)CCc3cc(OC)c(OC)c(OC)c3-4)cccc21 |
| InChI | InChI=1S/C36H42N4O7/c1-22(41)38-28-13-11-23-20-32(45-3)35(46-4)36(47-5)34(23)24-12-14-29(31(42)21-26(24)28)37-16-7-10-33(43)39-27-8-6-9-30-25(27)15-17-40(30)18-19-44-2/h6,8-9,12,14-15,17,20-21,28H,7,10-11,13,16,18-19H2,1-5H3,(H,37,42)(H,38,41)(H,39,43) |
| InChIKey | KDFCJLQGNYPEDS-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 129.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.75 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|