C34H40N4O8S — CID 163090830
4-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-N-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]butanamide (PubChem CID 163090830) has the molecular formula C34H40N4O8S and a molecular weight of 664.78 g/mol. Its IUPAC name is 4-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-N-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]butanamide.
| Compound Name | 4-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-N-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]butanamide |
|---|---|
| PubChem CID | 163090830 |
| Molecular Formula | C34H40N4O8S |
| Molecular Weight | 664.78 g/mol |
| Exact Mass | 664.26 |
| IUPAC Name | 4-[(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)amino]-N-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]butanamide |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(NCCCC(=O)Nc3ccc(N4CCCS4(=O)=O)cc3)c(=O)cc1C(NC(C)=O)CC2 |
| InChI | InChI=1S/C34H40N4O8S/c1-21(39)36-27-14-8-22-19-30(44-2)33(45-3)34(46-4)32(22)25-13-15-28(29(40)20-26(25)27)35-16-5-7-31(41)37-23-9-11-24(12-10-23)38-17-6-18-47(38,42)43/h9-13,15,19-20,27H,5-8,14,16-18H2,1-4H3,(H,35,40)(H,36,39)(H,37,41) |
| InChIKey | KWZQJTMVMXIUQM-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 152.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.78 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|