C27H35N3O7 — CID 6352930
(2S)-6-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-2-aminohexanoic acid (PubChem CID 6352930) has the molecular formula C27H35N3O7 and a molecular weight of 513.59 g/mol. Its IUPAC name is (2S)-6-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-2-aminohexanoic acid.
| Compound Name | (2S)-6-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-2-aminohexanoic acid |
|---|---|
| PubChem CID | 6352930 |
| Molecular Formula | C27H35N3O7 |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.25 |
| IUPAC Name | (2S)-6-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]amino]-2-aminohexanoic acid |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(NCCCC[C@H](N)C(=O)O)c(=O)cc1[C@@H](NC(C)=O)CC2 |
| InChI | InChI=1S/C27H35N3O7/c1-15(31)30-20-10-8-16-13-23(35-2)25(36-3)26(37-4)24(16)17-9-11-21(22(32)14-18(17)20)29-12-6-5-7-19(28)27(33)34/h9,11,13-14,19-20H,5-8,10,12,28H2,1-4H3,(H,29,32)(H,30,31)(H,33,34)/t19-,20-/m0/s1 |
| InChIKey | CCCBOTUEAVHMND-PMACEKPBSA-N |
| XLogP | 2.86 |
| TPSA | 149.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|