C20H23NO4S — CID 87413868
(7S)-7-amino-3-ethoxy-1,2-dimethoxy-10-sulfanyl-6,7-dihydro-5H-benzo[a]heptalen-9-one (PubChem CID 87413868) has the molecular formula C20H23NO4S and a molecular weight of 373.47 g/mol. Its IUPAC name is (7S)-7-amino-3-ethoxy-1,2-dimethoxy-10-sulfanyl-6,7-dihydro-5H-benzo[a]heptalen-9-one.
| Compound Name | (7S)-7-amino-3-ethoxy-1,2-dimethoxy-10-sulfanyl-6,7-dihydro-5H-benzo[a]heptalen-9-one |
|---|---|
| PubChem CID | 87413868 |
| Molecular Formula | C20H23NO4S |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | (7S)-7-amino-3-ethoxy-1,2-dimethoxy-10-sulfanyl-6,7-dihydro-5H-benzo[a]heptalen-9-one |
| SMILES | CCOc1cc2c(c(OC)c1OC)-c1ccc(S)c(=O)cc1[C@@H](N)CC2 |
| InChI | InChI=1S/C20H23NO4S/c1-4-25-16-9-11-5-7-14(21)13-10-15(22)17(26)8-6-12(13)18(11)20(24-3)19(16)23-2/h6,8-10,14H,4-5,7,21H2,1-3H3,(H,22,26)/t14-/m0/s1 |
| InChIKey | ZPKLNVXDOJDKHH-AWEZNQCLSA-N |
| XLogP | 3.36 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|