C29H29N3O9 — CID 58715620
[4-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]carbamoyl]phenyl]methyl nitrate (PubChem CID 58715620) has the molecular formula C29H29N3O9 and a molecular weight of 563.56 g/mol. Its IUPAC name is [4-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]carbamoyl]phenyl]methyl nitrate.
| Compound Name | [4-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]carbamoyl]phenyl]methyl nitrate |
|---|---|
| PubChem CID | 58715620 |
| Molecular Formula | C29H29N3O9 |
| Molecular Weight | 563.56 g/mol |
| Exact Mass | 563.19 |
| IUPAC Name | [4-[[(7S)-7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl]carbamoyl]phenyl]methyl nitrate |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(NC(=O)c3ccc(CO[N+](=O)[O-])cc3)c(=O)cc1[C@@H](NC(C)=O)CC2 |
| InChI | InChI=1S/C29H29N3O9/c1-16(33)30-22-11-9-19-13-25(38-2)27(39-3)28(40-4)26(19)20-10-12-23(24(34)14-21(20)22)31-29(35)18-7-5-17(6-8-18)15-41-32(36)37/h5-8,10,12-14,22H,9,11,15H2,1-4H3,(H,30,33)(H,31,34,35)/t22-/m0/s1 |
| InChIKey | PAIKTACLIFQRGM-QFIPXVFZSA-N |
| XLogP | 3.82 |
| TPSA | 155.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.56 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|