C29H29IN2O6 — CID 10145900
N-(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)-4-(iodomethyl)benzamide (PubChem CID 10145900) has the molecular formula C29H29IN2O6 and a molecular weight of 628.46 g/mol. Its IUPAC name is N-(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)-4-(iodomethyl)benzamide.
| Compound Name | N-(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)-4-(iodomethyl)benzamide |
|---|---|
| PubChem CID | 10145900 |
| Molecular Formula | C29H29IN2O6 |
| Molecular Weight | 628.46 g/mol |
| Exact Mass | 628.11 |
| IUPAC Name | N-(7-acetamido-1,2,3-trimethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-10-yl)-4-(iodomethyl)benzamide |
| SMILES | COc1cc2c(c(OC)c1OC)-c1ccc(NC(=O)c3ccc(CI)cc3)c(=O)cc1C(NC(C)=O)CC2 |
| InChI | InChI=1S/C29H29IN2O6/c1-16(33)31-22-11-9-19-13-25(36-2)27(37-3)28(38-4)26(19)20-10-12-23(24(34)14-21(20)22)32-29(35)18-7-5-17(15-30)6-8-18/h5-8,10,12-14,22H,9,11,15H2,1-4H3,(H,31,33)(H,32,34,35) |
| InChIKey | HEUMLKFGAMVREN-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.46 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|