C30H32N2O9S — CID 58715646
[4-[[(7S)-1,2,3-trimethoxy-4-(methoxymethyl)-10-methylsulfanyl-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]carbamoyl]phenyl]methyl nitrate (PubChem CID 58715646) has the molecular formula C30H32N2O9S and a molecular weight of 596.66 g/mol. Its IUPAC name is [4-[[(7S)-1,2,3-trimethoxy-4-(methoxymethyl)-10-methylsulfanyl-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]carbamoyl]phenyl]methyl nitrate.
| Compound Name | [4-[[(7S)-1,2,3-trimethoxy-4-(methoxymethyl)-10-methylsulfanyl-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]carbamoyl]phenyl]methyl nitrate |
|---|---|
| PubChem CID | 58715646 |
| Molecular Formula | C30H32N2O9S |
| Molecular Weight | 596.66 g/mol |
| Exact Mass | 596.18 |
| IUPAC Name | [4-[[(7S)-1,2,3-trimethoxy-4-(methoxymethyl)-10-methylsulfanyl-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]carbamoyl]phenyl]methyl nitrate |
| SMILES | COCc1c2c(c(OC)c(OC)c1OC)-c1ccc(SC)c(=O)cc1[C@@H](NC(=O)c1ccc(CO[N+](=O)[O-])cc1)CC2 |
| InChI | InChI=1S/C30H32N2O9S/c1-37-16-22-20-10-12-23(31-30(34)18-8-6-17(7-9-18)15-41-32(35)36)21-14-24(33)25(42-5)13-11-19(21)26(20)28(39-3)29(40-4)27(22)38-2/h6-9,11,13-14,23H,10,12,15-16H2,1-5H3,(H,31,34)/t23-/m0/s1 |
| InChIKey | ZFOIMEXUPHXDNP-QHCPKHFHSA-N |
| XLogP | 4.73 |
| TPSA | 135.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.66 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|