C23H23ClF3NO6S — CID 162666256
2,2,2-trifluoroethyl N-[(7S)-4-chloro-1,2,3-trimethoxy-10-methylsulfanyl-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]carbamate (PubChem CID 162666256) has the molecular formula C23H23ClF3NO6S and a molecular weight of 533.95 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N-[(7S)-4-chloro-1,2,3-trimethoxy-10-methylsulfanyl-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]carbamate.
| Compound Name | 2,2,2-trifluoroethyl N-[(7S)-4-chloro-1,2,3-trimethoxy-10-methylsulfanyl-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]carbamate |
|---|---|
| PubChem CID | 162666256 |
| Molecular Formula | C23H23ClF3NO6S |
| Molecular Weight | 533.95 g/mol |
| Exact Mass | 533.09 |
| IUPAC Name | 2,2,2-trifluoroethyl N-[(7S)-4-chloro-1,2,3-trimethoxy-10-methylsulfanyl-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]carbamate |
| SMILES | COc1c(Cl)c2c(c(OC)c1OC)-c1ccc(SC)c(=O)cc1[C@@H](NC(=O)OCC(F)(F)F)CC2 |
| InChI | InChI=1S/C23H23ClF3NO6S/c1-31-19-17-11-6-8-16(35-4)15(29)9-13(11)14(28-22(30)34-10-23(25,26)27)7-5-12(17)18(24)20(32-2)21(19)33-3/h6,8-9,14H,5,7,10H2,1-4H3,(H,28,30)/t14-/m0/s1 |
| InChIKey | GJGSEWVIKCCBLN-AWEZNQCLSA-N |
| XLogP | 5.39 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.95 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |