C26H26N2O9S — CID 11376174
[5-[[(7S)-2,3,4-trimethoxy-10-methylsulfanyl-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]carbamoyl]furan-2-yl]methyl nitrate (PubChem CID 11376174) has the molecular formula C26H26N2O9S and a molecular weight of 542.57 g/mol. Its IUPAC name is [5-[[(7S)-2,3,4-trimethoxy-10-methylsulfanyl-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]carbamoyl]furan-2-yl]methyl nitrate.
| Compound Name | [5-[[(7S)-2,3,4-trimethoxy-10-methylsulfanyl-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]carbamoyl]furan-2-yl]methyl nitrate |
|---|---|
| PubChem CID | 11376174 |
| Molecular Formula | C26H26N2O9S |
| Molecular Weight | 542.57 g/mol |
| Exact Mass | 542.14 |
| IUPAC Name | [5-[[(7S)-2,3,4-trimethoxy-10-methylsulfanyl-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]carbamoyl]furan-2-yl]methyl nitrate |
| SMILES | COc1cc2c(c(OC)c1OC)CC[C@H](NC(=O)c1ccc(CO[N+](=O)[O-])o1)c1cc(=O)c(SC)ccc1-2 |
| InChI | InChI=1S/C26H26N2O9S/c1-33-22-12-17-15-7-10-23(38-4)20(29)11-18(15)19(8-6-16(17)24(34-2)25(22)35-3)27-26(30)21-9-5-14(37-21)13-36-28(31)32/h5,7,9-12,19H,6,8,13H2,1-4H3,(H,27,30)/t19-/m0/s1 |
| InChIKey | YPHRHNCNAJSZPF-IBGZPJMESA-N |
| XLogP | 4.18 |
| TPSA | 139.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.57 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|