C24H19N3O9S — CID 10506270
3,5-dinitro-N-[(7S)-1,2,3-trihydroxy-10-methylsulfanyl-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]benzamide (PubChem CID 10506270) has the molecular formula C24H19N3O9S and a molecular weight of 525.50 g/mol. Its IUPAC name is 3,5-dinitro-N-[(7S)-1,2,3-trihydroxy-10-methylsulfanyl-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]benzamide.
| Compound Name | 3,5-dinitro-N-[(7S)-1,2,3-trihydroxy-10-methylsulfanyl-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]benzamide |
|---|---|
| PubChem CID | 10506270 |
| Molecular Formula | C24H19N3O9S |
| Molecular Weight | 525.50 g/mol |
| Exact Mass | 525.08 |
| IUPAC Name | 3,5-dinitro-N-[(7S)-1,2,3-trihydroxy-10-methylsulfanyl-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]benzamide |
| SMILES | CSc1ccc2c(cc1=O)[C@@H](NC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)CCc1cc(O)c(O)c(O)c1-2 |
| InChI | InChI=1S/C24H19N3O9S/c1-37-20-5-3-15-16(10-18(20)28)17(4-2-11-8-19(29)22(30)23(31)21(11)15)25-24(32)12-6-13(26(33)34)9-14(7-12)27(35)36/h3,5-10,17,29-31H,2,4H2,1H3,(H,25,32)/t17-/m0/s1 |
| InChIKey | VOGMCBJLCZNBPF-KRWDZBQOSA-N |
| XLogP | 3.79 |
| TPSA | 193.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.50 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|