C20H20BNO5 — CID 59843659
CID 59843659 (PubChem CID 59843659) has the molecular formula C20H20BNO5 and a molecular weight of 365.19 g/mol.
| Compound Name | CID 59843659 |
|---|---|
| PubChem CID | 59843659 |
| Molecular Formula | C20H20BNO5 |
| Molecular Weight | 365.19 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2c(cc1=O)[C@@H](NC=O)CCc1cc(OC)c(OC)c(OC)c1-2 |
| InChI | InChI=1S/C20H20BNO5/c1-25-17-8-11-4-7-15(22-10-23)13-9-16(24)14(21)6-5-12(13)18(11)20(27-3)19(17)26-2/h5-6,8-10,15H,4,7H2,1-3H3,(H,22,23)/t15-/m0/s1 |
| InChIKey | AOLVAJSSRAXNGF-HNNXBMFYSA-N |
| XLogP | 1.27 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.19 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|