C18H20O5S — CID 24960169
1,2,3,9-tetramethoxy-5,7-dihydrobenzo[d][2]benzoxepine-8-thiol (PubChem CID 24960169) has the molecular formula C18H20O5S and a molecular weight of 348.42 g/mol. Its IUPAC name is 1,2,3,9-tetramethoxy-5,7-dihydrobenzo[d][2]benzoxepine-8-thiol.
| Compound Name | 1,2,3,9-tetramethoxy-5,7-dihydrobenzo[d][2]benzoxepine-8-thiol |
|---|---|
| PubChem CID | 24960169 |
| Molecular Formula | C18H20O5S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 1,2,3,9-tetramethoxy-5,7-dihydrobenzo[d][2]benzoxepine-8-thiol |
| SMILES | COc1ccc2c(c1S)COCc1cc(OC)c(OC)c(OC)c1-2 |
| InChI | InChI=1S/C18H20O5S/c1-19-13-6-5-11-12(18(13)24)9-23-8-10-7-14(20-2)16(21-3)17(22-4)15(10)11/h5-7,24H,8-9H2,1-4H3 |
| InChIKey | QXUPTUCNOUHSNT-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 46.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|