C19H21NO5 — CID 11595354
(10R)-3,4,5-trimethoxy-10-methyl-14,16-dioxa-9-azatetracyclo[9.7.0.02,7.013,17]octadeca-1(18),2,4,6,11,13(17)-hexaene (PubChem CID 11595354) has the molecular formula C19H21NO5 and a molecular weight of 343.38 g/mol. Its IUPAC name is (10R)-3,4,5-trimethoxy-10-methyl-14,16-dioxa-9-azatetracyclo[9.7.0.02,7.013,17]octadeca-1(18),2,4,6,11,13(17)-hexaene.
| Compound Name | (10R)-3,4,5-trimethoxy-10-methyl-14,16-dioxa-9-azatetracyclo[9.7.0.02,7.013,17]octadeca-1(18),2,4,6,11,13(17)-hexaene |
|---|---|
| PubChem CID | 11595354 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | (10R)-3,4,5-trimethoxy-10-methyl-14,16-dioxa-9-azatetracyclo[9.7.0.02,7.013,17]octadeca-1(18),2,4,6,11,13(17)-hexaene |
| SMILES | COc1cc2c(c(OC)c1OC)-c1cc3c(cc1[C@@H](C)NC2)OCO3 |
| InChI | InChI=1S/C19H21NO5/c1-10-12-6-14-15(25-9-24-14)7-13(12)17-11(8-20-10)5-16(21-2)18(22-3)19(17)23-4/h5-7,10,20H,8-9H2,1-4H3/t10-/m1/s1 |
| InChIKey | BRBIPXCCKWAUQR-SNVBAGLBSA-N |
| XLogP | 3.27 |
| TPSA | 58.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |