C17H18O7 — CID 143698506
9,10,11-trimethoxy-5,7-dihydrobenzo[d][2]benzoxepine-2,3,4-triol (PubChem CID 143698506) has the molecular formula C17H18O7 and a molecular weight of 334.32 g/mol. Its IUPAC name is 9,10,11-trimethoxy-5,7-dihydrobenzo[d][2]benzoxepine-2,3,4-triol.
| Compound Name | 9,10,11-trimethoxy-5,7-dihydrobenzo[d][2]benzoxepine-2,3,4-triol |
|---|---|
| PubChem CID | 143698506 |
| Molecular Formula | C17H18O7 |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 9,10,11-trimethoxy-5,7-dihydrobenzo[d][2]benzoxepine-2,3,4-triol |
| SMILES | COc1cc2c(c(OC)c1OC)-c1cc(O)c(O)c(O)c1COC2 |
| InChI | InChI=1S/C17H18O7/c1-21-12-4-8-6-24-7-10-9(5-11(18)15(20)14(10)19)13(8)17(23-3)16(12)22-2/h4-5,18-20H,6-7H2,1-3H3 |
| InChIKey | QOBIUNVCKZZSHH-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|