C19H18O7 — CID 85266829
15,16,17-trimethoxy-5,7,11,19-tetraoxapentacyclo[10.8.0.02,10.04,8.013,18]icosa-2,4(8),9,13,15,17-hexaene (PubChem CID 85266829) has the molecular formula C19H18O7 and a molecular weight of 358.35 g/mol. Its IUPAC name is 15,16,17-trimethoxy-5,7,11,19-tetraoxapentacyclo[10.8.0.02,10.04,8.013,18]icosa-2,4(8),9,13,15,17-hexaene.
| Compound Name | 15,16,17-trimethoxy-5,7,11,19-tetraoxapentacyclo[10.8.0.02,10.04,8.013,18]icosa-2,4(8),9,13,15,17-hexaene |
|---|---|
| PubChem CID | 85266829 |
| Molecular Formula | C19H18O7 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 15,16,17-trimethoxy-5,7,11,19-tetraoxapentacyclo[10.8.0.02,10.04,8.013,18]icosa-2,4(8),9,13,15,17-hexaene |
| SMILES | COc1cc2c(c(OC)c1OC)OCC1c3cc4c(cc3OC21)OCO4 |
| InChI | InChI=1S/C19H18O7/c1-20-15-5-10-16-11(7-23-17(10)19(22-3)18(15)21-2)9-4-13-14(25-8-24-13)6-12(9)26-16/h4-6,11,16H,7-8H2,1-3H3 |
| InChIKey | WKTSZGRTOFXXAS-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |