C19H20O8 — CID 95224884
(6aS,11aR)-2,3,9,10-tetramethoxy-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromene-4,8-diol (PubChem CID 95224884) has the molecular formula C19H20O8 and a molecular weight of 376.36 g/mol. Its IUPAC name is (6aS,11aR)-2,3,9,10-tetramethoxy-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromene-4,8-diol.
| Compound Name | (6aS,11aR)-2,3,9,10-tetramethoxy-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromene-4,8-diol |
|---|---|
| PubChem CID | 95224884 |
| Molecular Formula | C19H20O8 |
| Molecular Weight | 376.36 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | (6aS,11aR)-2,3,9,10-tetramethoxy-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromene-4,8-diol |
| SMILES | COc1cc2c(c(O)c1OC)OC[C@@H]1c3cc(O)c(OC)c(OC)c3O[C@@H]21 |
| InChI | InChI=1S/C19H20O8/c1-22-12-6-9-14-10(7-26-15(9)13(21)18(12)24-3)8-5-11(20)17(23-2)19(25-4)16(8)27-14/h5-6,10,14,20-21H,7H2,1-4H3/t10-,14+/m1/s1 |
| InChIKey | GYUTYMPIMMYZHM-YGRLFVJLSA-N |
| XLogP | 2.74 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |