C24H18O4 — CID 15568466
(1R,13R)-4,16-dimethoxy-12,24-dioxahexacyclo[11.11.0.02,11.05,10.014,23.017,22]tetracosa-2(11),3,5,7,9,14(23),15,17,19,21-decaene (PubChem CID 15568466) has the molecular formula C24H18O4 and a molecular weight of 370.40 g/mol. Its IUPAC name is (1R,13R)-4,16-dimethoxy-12,24-dioxahexacyclo[11.11.0.02,11.05,10.014,23.017,22]tetracosa-2(11),3,5,7,9,14(23),15,17,19,21-decaene.
| Compound Name | (1R,13R)-4,16-dimethoxy-12,24-dioxahexacyclo[11.11.0.02,11.05,10.014,23.017,22]tetracosa-2(11),3,5,7,9,14(23),15,17,19,21-decaene |
|---|---|
| PubChem CID | 15568466 |
| Molecular Formula | C24H18O4 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | (1R,13R)-4,16-dimethoxy-12,24-dioxahexacyclo[11.11.0.02,11.05,10.014,23.017,22]tetracosa-2(11),3,5,7,9,14(23),15,17,19,21-decaene |
| SMILES | COc1cc2c(c3ccccc13)O[C@@H]1c3cc(OC)c4ccccc4c3O[C@H]21 |
| InChI | InChI=1S/C24H18O4/c1-25-19-11-17-21(15-9-5-3-7-13(15)19)27-24-18-12-20(26-2)14-8-4-6-10-16(14)22(18)28-23(17)24/h3-12,23-24H,1-2H3/t23-,24-/m1/s1 |
| InChIKey | HQGJFEAXSAZTFT-DNQXCXABSA-N |
| XLogP | 5.58 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |