C13H12O2 — CID 102108713
5-methoxy-2,3-dihydrobenzo[g][1]benzofuran (PubChem CID 102108713) has the molecular formula C13H12O2 and a molecular weight of 200.24 g/mol. Its IUPAC name is 5-methoxy-2,3-dihydrobenzo[g][1]benzofuran.
| Compound Name | 5-methoxy-2,3-dihydrobenzo[g][1]benzofuran |
|---|---|
| PubChem CID | 102108713 |
| Molecular Formula | C13H12O2 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 5-methoxy-2,3-dihydrobenzo[g][1]benzofuran |
| SMILES | COc1cc2c(c3ccccc13)OCC2 |
| InChI | InChI=1S/C13H12O2/c1-14-12-8-9-6-7-15-13(9)11-5-3-2-4-10(11)12/h2-5,8H,6-7H2,1H3 |
| InChIKey | VZGKWLGVWHTJGX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |