C9H10O2S — CID 168942495
6-methoxy-2,3-dihydro-1-benzofuran-7-thiol (PubChem CID 168942495) has the molecular formula C9H10O2S and a molecular weight of 182.24 g/mol. Its IUPAC name is 6-methoxy-2,3-dihydro-1-benzofuran-7-thiol.
| Compound Name | 6-methoxy-2,3-dihydro-1-benzofuran-7-thiol |
|---|---|
| PubChem CID | 168942495 |
| Molecular Formula | C9H10O2S |
| Molecular Weight | 182.24 g/mol |
| Exact Mass | 182.04 |
| IUPAC Name | 6-methoxy-2,3-dihydro-1-benzofuran-7-thiol |
| SMILES | COc1ccc2c(c1S)OCC2 |
| InChI | InChI=1S/C9H10O2S/c1-10-7-3-2-6-4-5-11-8(6)9(7)12/h2-3,12H,4-5H2,1H3 |
| InChIKey | KLHIISUXNLMAHF-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.24 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|