C11H14O2 — CID 170265985
5-ethyl-7-methoxy-2,3-dihydro-1-benzofuran (PubChem CID 170265985) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is 5-ethyl-7-methoxy-2,3-dihydro-1-benzofuran.
| Compound Name | 5-ethyl-7-methoxy-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 170265985 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 5-ethyl-7-methoxy-2,3-dihydro-1-benzofuran |
| SMILES | CCc1cc2c(c(OC)c1)OCC2 |
| InChI | InChI=1S/C11H14O2/c1-3-8-6-9-4-5-13-11(9)10(7-8)12-2/h6-7H,3-5H2,1-2H3 |
| InChIKey | UACFEVUJEFLGQW-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |