C14H21FO — CID 143668070
butane;5-ethyl-7-fluoro-2,3-dihydro-1-benzofuran (PubChem CID 143668070) has the molecular formula C14H21FO and a molecular weight of 224.32 g/mol. Its IUPAC name is butane;5-ethyl-7-fluoro-2,3-dihydro-1-benzofuran.
| Compound Name | butane;5-ethyl-7-fluoro-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 143668070 |
| Molecular Formula | C14H21FO |
| Molecular Weight | 224.32 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | butane;5-ethyl-7-fluoro-2,3-dihydro-1-benzofuran |
| SMILES | CCCC.CCc1cc(F)c2c(c1)CCO2 |
| InChI | InChI=1S/C10H11FO.C4H10/c1-2-7-5-8-3-4-12-10(8)9(11)6-7;1-3-4-2/h5-6H,2-4H2,1H3;3-4H2,1-2H3 |
| InChIKey | NOKJERNDZHDCPH-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.32 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |