C12H15FO — CID 89290968
8-fluoro-6-propan-2-yl-3,4-dihydro-2H-chromene (PubChem CID 89290968) has the molecular formula C12H15FO and a molecular weight of 194.25 g/mol. Its IUPAC name is 8-fluoro-6-propan-2-yl-3,4-dihydro-2H-chromene.
| Compound Name | 8-fluoro-6-propan-2-yl-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 89290968 |
| Molecular Formula | C12H15FO |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 8-fluoro-6-propan-2-yl-3,4-dihydro-2H-chromene |
| SMILES | CC(C)c1cc(F)c2c(c1)CCCO2 |
| InChI | InChI=1S/C12H15FO/c1-8(2)10-6-9-4-3-5-14-12(9)11(13)7-10/h6-8H,3-5H2,1-2H3 |
| InChIKey | MFBAGBLTDACMSX-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |