C9H8F2O — CID 69010256
6,8-difluoro-3,4-dihydro-2H-chromene (PubChem CID 69010256) has the molecular formula C9H8F2O and a molecular weight of 170.16 g/mol. Its IUPAC name is 6,8-difluoro-3,4-dihydro-2H-chromene.
| Compound Name | 6,8-difluoro-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 69010256 |
| Molecular Formula | C9H8F2O |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | 6,8-difluoro-3,4-dihydro-2H-chromene |
| SMILES | Fc1cc(F)c2c(c1)CCCO2 |
| InChI | InChI=1S/C9H8F2O/c10-7-4-6-2-1-3-12-9(6)8(11)5-7/h4-5H,1-3H2 |
| InChIKey | DGZAIYFFYUKQQT-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |