C11H15FO — CID 177214189
ethane;7-fluoro-5-methyl-2,3-dihydro-1-benzofuran (PubChem CID 177214189) has the molecular formula C11H15FO and a molecular weight of 182.24 g/mol. Its IUPAC name is ethane;7-fluoro-5-methyl-2,3-dihydro-1-benzofuran.
| Compound Name | ethane;7-fluoro-5-methyl-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 177214189 |
| Molecular Formula | C11H15FO |
| Molecular Weight | 182.24 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | ethane;7-fluoro-5-methyl-2,3-dihydro-1-benzofuran |
| SMILES | CC.Cc1cc(F)c2c(c1)CCO2 |
| InChI | InChI=1S/C9H9FO.C2H6/c1-6-4-7-2-3-11-9(7)8(10)5-6;1-2/h4-5H,2-3H2,1H3;1-2H3 |
| InChIKey | MZUCSKVEVRRQQM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.24 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |