C10H13OP — CID 143317684
methyl-(7-methyl-2,3-dihydro-1-benzofuran-5-yl)phosphane (PubChem CID 143317684) has the molecular formula C10H13OP and a molecular weight of 180.19 g/mol. Its IUPAC name is methyl-(7-methyl-2,3-dihydro-1-benzofuran-5-yl)phosphane.
| Compound Name | methyl-(7-methyl-2,3-dihydro-1-benzofuran-5-yl)phosphane |
|---|---|
| PubChem CID | 143317684 |
| Molecular Formula | C10H13OP |
| Molecular Weight | 180.19 g/mol |
| Exact Mass | 180.07 |
| IUPAC Name | methyl-(7-methyl-2,3-dihydro-1-benzofuran-5-yl)phosphane |
| SMILES | CPc1cc(C)c2c(c1)CCO2 |
| InChI | InChI=1S/C10H13OP/c1-7-5-9(12-2)6-8-3-4-11-10(7)8/h5-6,12H,3-4H2,1-2H3 |
| InChIKey | XXHWSIBPJKUIOB-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.19 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|