methyl N-(7-fluoro-2,3-dihydro-1-benzofuran-5-yl)carbamate

C10H10FNO3 — CID 175766387

IUPACmethyl N-(7-fluoro-2,3-dihydro-1-benzofuran-5-yl)carbamate
SMILESCOC(=O)Nc1cc(F)c2c(c1)CCO2
InChIInChI=1S/C10H10FNO3/c1-14-10(13)12-7-4-6-2-3-15-9(6)8(11)5-7/h4-5H,2-3H2,1H3,(H,12,13)
InChIKeyIGDARROWARYBHC-UHFFFAOYSA-N
MW211.19 g/mol
LogP1.94
Rot. Bonds1

About methyl N-(7-fluoro-2,3-dihydro-1-benzofuran-5-yl)carbamate

methyl N-(7-fluoro-2,3-dihydro-1-benzofuran-5-yl)carbamate (PubChem CID 175766387) has the molecular formula C10H10FNO3 and a molecular weight of 211.19 g/mol. Its IUPAC name is methyl N-(7-fluoro-2,3-dihydro-1-benzofuran-5-yl)carbamate.

Molecular Properties

Compound Namemethyl N-(7-fluoro-2,3-dihydro-1-benzofuran-5-yl)carbamate
PubChem CID175766387
Molecular FormulaC10H10FNO3
Molecular Weight211.19 g/mol
Exact Mass211.06
IUPAC Namemethyl N-(7-fluoro-2,3-dihydro-1-benzofuran-5-yl)carbamate
SMILESCOC(=O)Nc1cc(F)c2c(c1)CCO2
InChIInChI=1S/C10H10FNO3/c1-14-10(13)12-7-4-6-2-3-15-9(6)8(11)5-7/h4-5H,2-3H2,1H3,(H,12,13)
InChIKeyIGDARROWARYBHC-UHFFFAOYSA-N
XLogP1.94
TPSA47.56 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500211.19
LogP ≤ 51.94
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl N-(7-fluoro-2,3-dihydro-1-benzofuran-5-yl)carbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl N-(7-fluoro-2,3-dihydro-1-benzofuran-5-yl)carbamate?
The IUPAC name of methyl N-(7-fluoro-2,3-dihydro-1-benzofuran-5-yl)carbamate (CID 175766387) is methyl N-(7-fluoro-2,3-dihydro-1-benzofuran-5-yl)carbamate.
What is the SMILES notation for methyl N-(7-fluoro-2,3-dihydro-1-benzofuran-5-yl)carbamate?
The canonical SMILES for methyl N-(7-fluoro-2,3-dihydro-1-benzofuran-5-yl)carbamate is COC(=O)Nc1cc(F)c2c(c1)CCO2.
What is the InChIKey of methyl N-(7-fluoro-2,3-dihydro-1-benzofuran-5-yl)carbamate?
The InChIKey is IGDARROWARYBHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10FNO3/c1-14-10(13)12-7-4-6-2-3-15-9(6)8(11)5-7/h4-5H,2-3H2,1H3,(H,12,13).
What are the key properties of methyl N-(7-fluoro-2,3-dihydro-1-benzofuran-5-yl)carbamate?
methyl N-(7-fluoro-2,3-dihydro-1-benzofuran-5-yl)carbamate has a molecular weight of 211.19 g/mol, XLogP of 1.94, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-(7-fluoro-2,3-dihydro-1-benzofuran-5-yl)carbamate is sourced from PubChem (CID 175766387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).