C10H10FNO3 — CID 175766387
methyl N-(7-fluoro-2,3-dihydro-1-benzofuran-5-yl)carbamate (PubChem CID 175766387) has the molecular formula C10H10FNO3 and a molecular weight of 211.19 g/mol. Its IUPAC name is methyl N-(7-fluoro-2,3-dihydro-1-benzofuran-5-yl)carbamate.
| Compound Name | methyl N-(7-fluoro-2,3-dihydro-1-benzofuran-5-yl)carbamate |
|---|---|
| PubChem CID | 175766387 |
| Molecular Formula | C10H10FNO3 |
| Molecular Weight | 211.19 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | methyl N-(7-fluoro-2,3-dihydro-1-benzofuran-5-yl)carbamate |
| SMILES | COC(=O)Nc1cc(F)c2c(c1)CCO2 |
| InChI | InChI=1S/C10H10FNO3/c1-14-10(13)12-7-4-6-2-3-15-9(6)8(11)5-7/h4-5H,2-3H2,1H3,(H,12,13) |
| InChIKey | IGDARROWARYBHC-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.19 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |