C10H9BrO3 — CID 131617097
methyl 7-bromo-2,3-dihydro-1-benzofuran-5-carboxylate (PubChem CID 131617097) has the molecular formula C10H9BrO3 and a molecular weight of 257.08 g/mol. Its IUPAC name is methyl 7-bromo-2,3-dihydro-1-benzofuran-5-carboxylate.
| Compound Name | methyl 7-bromo-2,3-dihydro-1-benzofuran-5-carboxylate |
|---|---|
| PubChem CID | 131617097 |
| Molecular Formula | C10H9BrO3 |
| Molecular Weight | 257.08 g/mol |
| Exact Mass | 255.97 |
| IUPAC Name | methyl 7-bromo-2,3-dihydro-1-benzofuran-5-carboxylate |
| SMILES | COC(=O)c1cc(Br)c2c(c1)CCO2 |
| InChI | InChI=1S/C10H9BrO3/c1-13-10(12)7-4-6-2-3-14-9(6)8(11)5-7/h4-5H,2-3H2,1H3 |
| InChIKey | QIODYDLLNWOWAK-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.08 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |