About methyl 9-bromo-4-methyl-2,5-dihydro-1-benzoxepine-7-carboxylate
methyl 9-bromo-4-methyl-2,5-dihydro-1-benzoxepine-7-carboxylate (PubChem CID 118096707) has the molecular formula C13H13BrO3
and a molecular weight of 297.15 g/mol. Its IUPAC name is methyl 9-bromo-4-methyl-2,5-dihydro-1-benzoxepine-7-carboxylate.
Molecular Properties
| Compound Name | methyl 9-bromo-4-methyl-2,5-dihydro-1-benzoxepine-7-carboxylate |
| PubChem CID | 118096707 |
| Molecular Formula | C13H13BrO3 |
| Molecular Weight | 297.15 g/mol |
| Exact Mass | 296.00 |
| IUPAC Name | methyl 9-bromo-4-methyl-2,5-dihydro-1-benzoxepine-7-carboxylate |
| SMILES | COC(=O)c1cc(Br)c2c(c1)CC(C)=CCO2 |
| InChI | InChI=1S/C13H13BrO3/c1-8-3-4-17-12-9(5-8)6-10(7-11(12)14)13(15)16-2/h3,6-7H,4-5H2,1-2H3 |
| InChIKey | UYBCBLDUCVNCIJ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.15 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 9-bromo-4-methyl-2,5-dihydro-1-benzoxepine-7-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 9-bromo-4-methyl-2,5-dihydro-1-benzoxepine-7-carboxylate?
The IUPAC name of methyl 9-bromo-4-methyl-2,5-dihydro-1-benzoxepine-7-carboxylate (CID 118096707) is methyl 9-bromo-4-methyl-2,5-dihydro-1-benzoxepine-7-carboxylate.
What is the SMILES notation for methyl 9-bromo-4-methyl-2,5-dihydro-1-benzoxepine-7-carboxylate?
The canonical SMILES for methyl 9-bromo-4-methyl-2,5-dihydro-1-benzoxepine-7-carboxylate is COC(=O)c1cc(Br)c2c(c1)CC(C)=CCO2.
What is the InChIKey of methyl 9-bromo-4-methyl-2,5-dihydro-1-benzoxepine-7-carboxylate?
The InChIKey is UYBCBLDUCVNCIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13BrO3/c1-8-3-4-17-12-9(5-8)6-10(7-11(12)14)13(15)16-2/h3,6-7H,4-5H2,1-2H3.
What are the key properties of methyl 9-bromo-4-methyl-2,5-dihydro-1-benzoxepine-7-carboxylate?
methyl 9-bromo-4-methyl-2,5-dihydro-1-benzoxepine-7-carboxylate has a molecular weight of 297.15 g/mol, XLogP of 3.12, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 9-bromo-4-methyl-2,5-dihydro-1-benzoxepine-7-carboxylate is sourced from PubChem (CID 118096707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).