C9H9BrO2 — CID 66545161
(7-bromo-2,3-dihydro-1-benzofuran-5-yl)methanol (PubChem CID 66545161) has the molecular formula C9H9BrO2 and a molecular weight of 229.07 g/mol. Its IUPAC name is (7-bromo-2,3-dihydro-1-benzofuran-5-yl)methanol.
| Compound Name | (7-bromo-2,3-dihydro-1-benzofuran-5-yl)methanol |
|---|---|
| PubChem CID | 66545161 |
| Molecular Formula | C9H9BrO2 |
| Molecular Weight | 229.07 g/mol |
| Exact Mass | 227.98 |
| IUPAC Name | (7-bromo-2,3-dihydro-1-benzofuran-5-yl)methanol |
| SMILES | OCc1cc(Br)c2c(c1)CCO2 |
| InChI | InChI=1S/C9H9BrO2/c10-8-4-6(5-11)3-7-1-2-12-9(7)8/h3-4,11H,1-2,5H2 |
| InChIKey | FUUZXKAWKKIDRQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.07 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |