C8H6BrNO3 — CID 18787034
7-bromo-5-nitro-2,3-dihydro-1-benzofuran (PubChem CID 18787034) has the molecular formula C8H6BrNO3 and a molecular weight of 244.04 g/mol. Its IUPAC name is 7-bromo-5-nitro-2,3-dihydro-1-benzofuran.
| Compound Name | 7-bromo-5-nitro-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 18787034 |
| Molecular Formula | C8H6BrNO3 |
| Molecular Weight | 244.04 g/mol |
| Exact Mass | 242.95 |
| IUPAC Name | 7-bromo-5-nitro-2,3-dihydro-1-benzofuran |
| SMILES | O=[N+]([O-])c1cc(Br)c2c(c1)CCO2 |
| InChI | InChI=1S/C8H6BrNO3/c9-7-4-6(10(11)12)3-5-1-2-13-8(5)7/h3-4H,1-2H2 |
| InChIKey | ULJSVASNGUQURU-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.04 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|