C7H5ClN2O3 — CID 10536056
7-chloro-5-nitro-2,3-dihydrofuro[2,3-c]pyridine (PubChem CID 10536056) has the molecular formula C7H5ClN2O3 and a molecular weight of 200.58 g/mol. Its IUPAC name is 7-chloro-5-nitro-2,3-dihydrofuro[2,3-c]pyridine.
| Compound Name | 7-chloro-5-nitro-2,3-dihydrofuro[2,3-c]pyridine |
|---|---|
| PubChem CID | 10536056 |
| Molecular Formula | C7H5ClN2O3 |
| Molecular Weight | 200.58 g/mol |
| Exact Mass | 200.00 |
| IUPAC Name | 7-chloro-5-nitro-2,3-dihydrofuro[2,3-c]pyridine |
| SMILES | O=[N+]([O-])c1cc2c(c(Cl)n1)OCC2 |
| InChI | InChI=1S/C7H5ClN2O3/c8-7-6-4(1-2-13-6)3-5(9-7)10(11)12/h3H,1-2H2 |
| InChIKey | GGJRZXQENSBZAA-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.58 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|