C8H6ClFO3S — CID 165461315
5-chloro-2,3-dihydro-1-benzofuran-7-sulfonyl fluoride (PubChem CID 165461315) has the molecular formula C8H6ClFO3S and a molecular weight of 236.65 g/mol. Its IUPAC name is 5-chloro-2,3-dihydro-1-benzofuran-7-sulfonyl fluoride.
| Compound Name | 5-chloro-2,3-dihydro-1-benzofuran-7-sulfonyl fluoride |
|---|---|
| PubChem CID | 165461315 |
| Molecular Formula | C8H6ClFO3S |
| Molecular Weight | 236.65 g/mol |
| Exact Mass | 235.97 |
| IUPAC Name | 5-chloro-2,3-dihydro-1-benzofuran-7-sulfonyl fluoride |
| SMILES | O=S(=O)(F)c1cc(Cl)cc2c1OCC2 |
| InChI | InChI=1S/C8H6ClFO3S/c9-6-3-5-1-2-13-8(5)7(4-6)14(10,11)12/h3-4H,1-2H2 |
| InChIKey | JSPNAVMCIRQYKZ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.65 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |